C30H46O8 — CID 45050635
7-[(2R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-10,14-dimethyl-19,21-dioxahexacyclo[13.6.2.01,14.02,11.05,10.016,20]tricosan-18-one (PubChem CID 45050635) has the molecular formula C30H46O8 and a molecular weight of 534.69 g/mol. Its IUPAC name is 7-[(2R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-10,14-dimethyl-19,21-dioxahexacyclo[13.6.2.01,14.02,11.05,10.016,20]tricosan-18-one.
| Compound Name | 7-[(2R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-10,14-dimethyl-19,21-dioxahexacyclo[13.6.2.01,14.02,11.05,10.016,20]tricosan-18-one |
|---|---|
| PubChem CID | 45050635 |
| Molecular Formula | C30H46O8 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | 7-[(2R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-10,14-dimethyl-19,21-dioxahexacyclo[13.6.2.01,14.02,11.05,10.016,20]tricosan-18-one |
| SMILES | COC1C(O)C(C)O[C@@H](OC2CCC3(C)C(CCC4C3CCC3(C)C5CCC43OC3OC(=O)CC35)C2)C1O |
| InChI | InChI=1S/C30H46O8/c1-15-23(32)25(34-4)24(33)27(35-15)36-17-7-10-28(2)16(13-17)5-6-21-20(28)8-11-29(3)19-9-12-30(21,29)38-26-18(19)14-22(31)37-26/h15-21,23-27,32-33H,5-14H2,1-4H3/t15?,16?,17?,18?,19?,20?,21?,23?,24?,25?,26?,27-,28?,29?,30?/m0/s1 |
| InChIKey | ADDYOHTYICXYDD-YDOBVXOBSA-N |
| XLogP | 3.55 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|