C32H22N2O5 — CID 45051069
dimethyl 11-(4-phenylbenzoyl)pyrrolo[1,2-a][1,10]phenanthroline-9,10-dicarboxylate (PubChem CID 45051069) has the molecular formula C32H22N2O5 and a molecular weight of 514.54 g/mol. Its IUPAC name is dimethyl 11-(4-phenylbenzoyl)pyrrolo[1,2-a][1,10]phenanthroline-9,10-dicarboxylate.
| Compound Name | dimethyl 11-(4-phenylbenzoyl)pyrrolo[1,2-a][1,10]phenanthroline-9,10-dicarboxylate |
|---|---|
| PubChem CID | 45051069 |
| Molecular Formula | C32H22N2O5 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | dimethyl 11-(4-phenylbenzoyl)pyrrolo[1,2-a][1,10]phenanthroline-9,10-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2ccc3ccc4cccnc4c3n2c1C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H22N2O5/c1-38-31(36)25-24-17-16-22-13-12-21-9-6-18-33-27(21)28(22)34(24)29(26(25)32(37)39-2)30(35)23-14-10-20(11-15-23)19-7-4-3-5-8-19/h3-18H,1-2H3 |
| InChIKey | RTPSMKBCYFTVFA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|