C24H25NO2 — CID 45051087
(4-tert-butylphenyl) 1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 45051087) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (4-tert-butylphenyl) 1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | (4-tert-butylphenyl) 1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 45051087 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (4-tert-butylphenyl) 1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CC(C)(C)c1ccc(OC(=O)c2c3c(nc4ccccc24)CCCC3)cc1 |
| InChI | InChI=1S/C24H25NO2/c1-24(2,3)16-12-14-17(15-13-16)27-23(26)22-18-8-4-6-10-20(18)25-21-11-7-5-9-19(21)22/h4,6,8,10,12-15H,5,7,9,11H2,1-3H3 |
| InChIKey | UACWREFABLXUNK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|