About N-(2-oxo-1,3-diazinan-4-yl)acetamide
N-(2-oxo-1,3-diazinan-4-yl)acetamide (PubChem CID 45051553) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is N-(2-oxo-1,3-diazinan-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-oxo-1,3-diazinan-4-yl)acetamide |
| PubChem CID | 45051553 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N-(2-oxo-1,3-diazinan-4-yl)acetamide |
| SMILES | CC(=O)NC1CCNC(=O)N1 |
| InChI | InChI=1S/C6H11N3O2/c1-4(10)8-5-2-3-7-6(11)9-5/h5H,2-3H2,1H3,(H,8,10)(H2,7,9,11) |
| InChIKey | WQSNLWQYPSTLEI-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-oxo-1,3-diazinan-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxo-1,3-diazinan-4-yl)acetamide?
The IUPAC name of N-(2-oxo-1,3-diazinan-4-yl)acetamide (CID 45051553) is N-(2-oxo-1,3-diazinan-4-yl)acetamide.
What is the SMILES notation for N-(2-oxo-1,3-diazinan-4-yl)acetamide?
The canonical SMILES for N-(2-oxo-1,3-diazinan-4-yl)acetamide is CC(=O)NC1CCNC(=O)N1.
What is the InChIKey of N-(2-oxo-1,3-diazinan-4-yl)acetamide?
The InChIKey is WQSNLWQYPSTLEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2/c1-4(10)8-5-2-3-7-6(11)9-5/h5H,2-3H2,1H3,(H,8,10)(H2,7,9,11).
What are the key properties of N-(2-oxo-1,3-diazinan-4-yl)acetamide?
N-(2-oxo-1,3-diazinan-4-yl)acetamide has a molecular weight of 157.17 g/mol, XLogP of -0.85, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxo-1,3-diazinan-4-yl)acetamide is sourced from PubChem (CID 45051553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).