About Sodium hexamethyidisilazane
Sodium hexamethyidisilazane (PubChem CID 45051731) has the molecular formula C6H19NNaSi2
and a molecular weight of 184.39 g/mol.
Molecular Properties
| Compound Name | Sodium hexamethyidisilazane |
| PubChem CID | 45051731 |
| Molecular Formula | C6H19NNaSi2 |
| Molecular Weight | 184.39 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)N[Si](C)(C)C.[Na] |
| InChI | InChI=1S/C6H19NSi2.Na/c1-8(2,3)7-9(4,5)6;/h7H,1-6H3; |
| InChIKey | QKNDAUTYSODFJV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Sodium hexamethyidisilazane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sodium hexamethyidisilazane?
The IUPAC name of Sodium hexamethyidisilazane (CID 45051731) is not available.
What is the SMILES notation for Sodium hexamethyidisilazane?
The canonical SMILES for Sodium hexamethyidisilazane is C[Si](C)(C)N[Si](C)(C)C.[Na].
What is the InChIKey of Sodium hexamethyidisilazane?
The InChIKey is QKNDAUTYSODFJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H19NSi2.Na/c1-8(2,3)7-9(4,5)6;/h7H,1-6H3;.
What are the key properties of Sodium hexamethyidisilazane?
Sodium hexamethyidisilazane has a molecular weight of 184.39 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Sodium hexamethyidisilazane is sourced from PubChem (CID 45051731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).