C64H120N8O8 — CID 45051952
5,8,14,17,23,26,32,35-octabutoxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 45051952) has the molecular formula C64H120N8O8 and a molecular weight of 1129.71 g/mol. Its IUPAC name is 5,8,14,17,23,26,32,35-octabutoxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 5,8,14,17,23,26,32,35-octabutoxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 45051952 |
| Molecular Formula | C64H120N8O8 |
| Molecular Weight | 1129.71 g/mol |
| Exact Mass | 1128.92 |
| IUPAC Name | 5,8,14,17,23,26,32,35-octabutoxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | CCCCOC1CCC(OCCCC)C2C3NC(NC4NC(NC5NC(NC6NC(N3)C3C(OCCCC)CCC(OCCCC)C63)C3C(OCCCC)CCC(OCCCC)C53)C3C(OCCCC)CCC(OCCCC)C43)C12 |
| InChI | InChI=1S/C64H120N8O8/c1-9-17-33-73-41-25-26-42(74-34-18-10-2)50-49(41)57-65-58(50)70-60-53-45(77-37-21-13-5)29-30-46(78-38-22-14-6)54(53)62(67-60)72-64-56-48(80-40-24-16-8)32-31-47(79-39-23-15-7)55(56)63(68-64)71-61-52-44(76-36-20-12-4)28-27-43(75-35-19-11-3)51(52)59(66-61)69-57/h41-72H,9-40H2,1-8H3 |
| InChIKey | SCJYYTMBZZOTJL-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 170.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 80 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1129.71 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|