C48H88N8 — CID 45051993
6,15,24,33-tetratert-butyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 45051993) has the molecular formula C48H88N8 and a molecular weight of 777.29 g/mol. Its IUPAC name is 6,15,24,33-tetratert-butyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 6,15,24,33-tetratert-butyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 45051993 |
| Molecular Formula | C48H88N8 |
| Molecular Weight | 777.29 g/mol |
| Exact Mass | 776.71 |
| IUPAC Name | 6,15,24,33-tetratert-butyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | CC(C)(C)C1CCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CC(C(C)(C)C)CCC63)C3CC(C(C)(C)C)CCC53)C3CC(C(C)(C)C)CCC43)C2C1 |
| InChI | InChI=1S/C48H88N8/c1-45(2,3)25-13-17-29-33(21-25)41-49-37(29)54-42-35-23-27(47(7,8)9)15-19-31(35)39(51-42)56-44-36-24-28(48(10,11)12)16-20-32(36)40(52-44)55-43-34-22-26(46(4,5)6)14-18-30(34)38(50-43)53-41/h25-44,49-56H,13-24H2,1-12H3 |
| InChIKey | AUJBAAYHECYNQS-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.29 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |