About CID 45052171
CID 45052171 (PubChem CID 45052171) has the molecular formula C8H14O2Si
and a molecular weight of 170.28 g/mol.
Molecular Properties
| Compound Name | CID 45052171 |
| PubChem CID | 45052171 |
| Molecular Formula | C8H14O2Si |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | — |
| SMILES | CCC1CCC2OC2C1.O=[Si] |
| InChI | InChI=1S/C8H14O.OSi/c1-2-6-3-4-7-8(5-6)9-7;1-2/h6-8H,2-5H2,1H3; |
| InChIKey | HMUALHQQXDWZQJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 45052171 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 45052171?
The IUPAC name of CID 45052171 (CID 45052171) is not available.
What is the SMILES notation for CID 45052171?
The canonical SMILES for CID 45052171 is CCC1CCC2OC2C1.O=[Si].
What is the InChIKey of CID 45052171?
The InChIKey is HMUALHQQXDWZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.OSi/c1-2-6-3-4-7-8(5-6)9-7;1-2/h6-8H,2-5H2,1H3;.
What are the key properties of CID 45052171?
CID 45052171 has a molecular weight of 170.28 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 45052171 is sourced from PubChem (CID 45052171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).