About 1,2,4,5-tetradeuteriobenzene
1,2,4,5-tetradeuteriobenzene (PubChem CID 45052197) has the molecular formula C6H6
and a molecular weight of 82.14 g/mol. Its IUPAC name is 1,2,4,5-tetradeuteriobenzene.
Molecular Properties
| Compound Name | 1,2,4,5-tetradeuteriobenzene |
| PubChem CID | 45052197 |
| Molecular Formula | C6H6 |
| Molecular Weight | 82.14 g/mol |
| Exact Mass | 82.07 |
| IUPAC Name | 1,2,4,5-tetradeuteriobenzene |
| SMILES | [2H]c1cc([2H])c([2H])cc1[2H] |
| InChI | InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H/i1D,2D,5D,6D |
| InChIKey | UHOVQNZJYSORNB-NMRLXUNGSA-N |
| XLogP | 1.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 82.14 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2,4,5-tetradeuteriobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4,5-tetradeuteriobenzene?
The IUPAC name of 1,2,4,5-tetradeuteriobenzene (CID 45052197) is 1,2,4,5-tetradeuteriobenzene.
What is the SMILES notation for 1,2,4,5-tetradeuteriobenzene?
The canonical SMILES for 1,2,4,5-tetradeuteriobenzene is [2H]c1cc([2H])c([2H])cc1[2H].
What is the InChIKey of 1,2,4,5-tetradeuteriobenzene?
The InChIKey is UHOVQNZJYSORNB-NMRLXUNGSA-N. The full InChI is InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H/i1D,2D,5D,6D.
What are the key properties of 1,2,4,5-tetradeuteriobenzene?
1,2,4,5-tetradeuteriobenzene has a molecular weight of 82.14 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4,5-tetradeuteriobenzene is sourced from PubChem (CID 45052197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).