About 9-methyl-4,5-dihydro-3H-purine-2,6-dione
9-methyl-4,5-dihydro-3H-purine-2,6-dione (PubChem CID 45052249) has the molecular formula C6H8N4O2
and a molecular weight of 168.16 g/mol. Its IUPAC name is 9-methyl-4,5-dihydro-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | 9-methyl-4,5-dihydro-3H-purine-2,6-dione |
| PubChem CID | 45052249 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 9-methyl-4,5-dihydro-3H-purine-2,6-dione |
| SMILES | CN1C=NC2C(=O)NC(=O)NC21 |
| InChI | InChI=1S/C6H8N4O2/c1-10-2-7-3-4(10)8-6(12)9-5(3)11/h2-4H,1H3,(H2,8,9,11,12) |
| InChIKey | JZIXPCDOYXBVRG-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methyl-4,5-dihydro-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-4,5-dihydro-3H-purine-2,6-dione?
The IUPAC name of 9-methyl-4,5-dihydro-3H-purine-2,6-dione (CID 45052249) is 9-methyl-4,5-dihydro-3H-purine-2,6-dione.
What is the SMILES notation for 9-methyl-4,5-dihydro-3H-purine-2,6-dione?
The canonical SMILES for 9-methyl-4,5-dihydro-3H-purine-2,6-dione is CN1C=NC2C(=O)NC(=O)NC21.
What is the InChIKey of 9-methyl-4,5-dihydro-3H-purine-2,6-dione?
The InChIKey is JZIXPCDOYXBVRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2/c1-10-2-7-3-4(10)8-6(12)9-5(3)11/h2-4H,1H3,(H2,8,9,11,12).
What are the key properties of 9-methyl-4,5-dihydro-3H-purine-2,6-dione?
9-methyl-4,5-dihydro-3H-purine-2,6-dione has a molecular weight of 168.16 g/mol, XLogP of -1.51, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-4,5-dihydro-3H-purine-2,6-dione is sourced from PubChem (CID 45052249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).