About (2R)-1,2-dibromocyclohexane
(2R)-1,2-dibromocyclohexane (PubChem CID 45052449) has the molecular formula C6H10Br2
and a molecular weight of 241.95 g/mol. Its IUPAC name is (2R)-1,2-dibromocyclohexane.
Molecular Properties
| Compound Name | (2R)-1,2-dibromocyclohexane |
| PubChem CID | 45052449 |
| Molecular Formula | C6H10Br2 |
| Molecular Weight | 241.95 g/mol |
| Exact Mass | 239.91 |
| IUPAC Name | (2R)-1,2-dibromocyclohexane |
| SMILES | BrC1CCCC[C@H]1Br |
| InChI | InChI=1S/C6H10Br2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6?/m1/s1 |
| InChIKey | CZNHKZKWKJNOTE-LWOQYNTDSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.95 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,2-dibromocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,2-dibromocyclohexane?
The IUPAC name of (2R)-1,2-dibromocyclohexane (CID 45052449) is (2R)-1,2-dibromocyclohexane.
What is the SMILES notation for (2R)-1,2-dibromocyclohexane?
The canonical SMILES for (2R)-1,2-dibromocyclohexane is BrC1CCCC[C@H]1Br.
What is the InChIKey of (2R)-1,2-dibromocyclohexane?
The InChIKey is CZNHKZKWKJNOTE-LWOQYNTDSA-N. The full InChI is InChI=1S/C6H10Br2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6?/m1/s1.
What are the key properties of (2R)-1,2-dibromocyclohexane?
(2R)-1,2-dibromocyclohexane has a molecular weight of 241.95 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,2-dibromocyclohexane is sourced from PubChem (CID 45052449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).