C13H16BrCl2N3 — CID 45052783
2,6-dichloro-N-[(E)-3,4,5,6-tetrahydro-2H-azepin-7-ylmethylideneamino]aniline;hydrobromide (PubChem CID 45052783) has the molecular formula C13H16BrCl2N3 and a molecular weight of 365.10 g/mol. Its IUPAC name is 2,6-dichloro-N-[(E)-3,4,5,6-tetrahydro-2H-azepin-7-ylmethylideneamino]aniline;hydrobromide.
| Compound Name | 2,6-dichloro-N-[(E)-3,4,5,6-tetrahydro-2H-azepin-7-ylmethylideneamino]aniline;hydrobromide |
|---|---|
| PubChem CID | 45052783 |
| Molecular Formula | C13H16BrCl2N3 |
| Molecular Weight | 365.10 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 2,6-dichloro-N-[(E)-3,4,5,6-tetrahydro-2H-azepin-7-ylmethylideneamino]aniline;hydrobromide |
| SMILES | Br.Clc1cccc(Cl)c1N/N=C/C1=NCCCCC1 |
| InChI | InChI=1S/C13H15Cl2N3.BrH/c14-11-6-4-7-12(15)13(11)18-17-9-10-5-2-1-3-8-16-10;/h4,6-7,9,18H,1-3,5,8H2;1H/b17-9+; |
| InChIKey | LURXYDZKFDRZGM-WWIHJBQESA-N |
| XLogP | 4.98 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.10 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|