About (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide
(4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide (PubChem CID 45052927) has the molecular formula C34H35BN2O2
and a molecular weight of 514.48 g/mol. Its IUPAC name is (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide.
Molecular Properties
| Compound Name | (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide |
| PubChem CID | 45052927 |
| Molecular Formula | C34H35BN2O2 |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide |
| SMILES | CCc1cc[n+](OC(=O)N(C)C)cc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C10H15N2O2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4-9-5-7-12(8-6-9)14-10(13)11(2)3/h1-20H;5-8H,4H2,1-3H3/q-1;+1 |
| InChIKey | UDZBCBZYQHFYSW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide?
The IUPAC name of (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide (CID 45052927) is (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide.
What is the SMILES notation for (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide?
The canonical SMILES for (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide is CCc1cc[n+](OC(=O)N(C)C)cc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide?
The InChIKey is UDZBCBZYQHFYSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C10H15N2O2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4-9-5-7-12(8-6-9)14-10(13)11(2)3/h1-20H;5-8H,4H2,1-3H3/q-1;+1.
What are the key properties of (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide?
(4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide has a molecular weight of 514.48 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylpyridin-1-ium-1-yl) N,N-dimethylcarbamate;tetraphenylboranuide is sourced from PubChem (CID 45052927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).