About 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride
1-(diaminomethylidene)-2-propylguanidine;dihydrochloride (PubChem CID 45053542) has the molecular formula C5H15Cl2N5
and a molecular weight of 216.12 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride |
| PubChem CID | 45053542 |
| Molecular Formula | C5H15Cl2N5 |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride |
| SMILES | CCC/N=C(\N)N=C(N)N.Cl.Cl |
| InChI | InChI=1S/C5H13N5.2ClH/c1-2-3-9-5(8)10-4(6)7;;/h2-3H2,1H3,(H6,6,7,8,9,10);2*1H |
| InChIKey | KENDAMGAPHPFON-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride?
The IUPAC name of 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride (CID 45053542) is 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride.
What is the SMILES notation for 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride?
The canonical SMILES for 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride is CCC/N=C(\N)N=C(N)N.Cl.Cl.
What is the InChIKey of 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride?
The InChIKey is KENDAMGAPHPFON-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N5.2ClH/c1-2-3-9-5(8)10-4(6)7;;/h2-3H2,1H3,(H6,6,7,8,9,10);2*1H.
What are the key properties of 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride?
1-(diaminomethylidene)-2-propylguanidine;dihydrochloride has a molecular weight of 216.12 g/mol, XLogP of -0.17, 2 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diaminomethylidene)-2-propylguanidine;dihydrochloride is sourced from PubChem (CID 45053542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).