C24H17N5O4S — CID 4505609
2-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione (PubChem CID 4505609) has the molecular formula C24H17N5O4S and a molecular weight of 471.50 g/mol. Its IUPAC name is 2-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione.
| Compound Name | 2-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
|---|---|
| PubChem CID | 4505609 |
| Molecular Formula | C24H17N5O4S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylidene]-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7-dione |
| SMILES | Cc1nn2c(=O)c(=Cc3cn(-c4ccccc4)nc3-c3ccc4c(c3)OCCO4)sc2nc1=O |
| InChI | InChI=1S/C24H17N5O4S/c1-14-22(30)25-24-29(26-14)23(31)20(34-24)12-16-13-28(17-5-3-2-4-6-17)27-21(16)15-7-8-18-19(11-15)33-10-9-32-18/h2-8,11-13H,9-10H2,1H3 |
| InChIKey | ZADZQLLKKRLJKZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_H(5)', 'substructure': 'N/A'} |
|---|