About 5-chloro-2,4-dimethoxy-6-methylpyrimidine
5-chloro-2,4-dimethoxy-6-methylpyrimidine (PubChem CID 45058582) has the molecular formula C7H9ClN2O2
and a molecular weight of 188.61 g/mol. Its IUPAC name is 5-chloro-2,4-dimethoxy-6-methylpyrimidine.
Molecular Properties
| Compound Name | 5-chloro-2,4-dimethoxy-6-methylpyrimidine |
| PubChem CID | 45058582 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 5-chloro-2,4-dimethoxy-6-methylpyrimidine |
| SMILES | COc1nc(C)c(Cl)c(OC)n1 |
| InChI | InChI=1S/C7H9ClN2O2/c1-4-5(8)6(11-2)10-7(9-4)12-3/h1-3H3 |
| InChIKey | BVDYUCCIJBGAEF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2,4-dimethoxy-6-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,4-dimethoxy-6-methylpyrimidine?
The IUPAC name of 5-chloro-2,4-dimethoxy-6-methylpyrimidine (CID 45058582) is 5-chloro-2,4-dimethoxy-6-methylpyrimidine.
What is the SMILES notation for 5-chloro-2,4-dimethoxy-6-methylpyrimidine?
The canonical SMILES for 5-chloro-2,4-dimethoxy-6-methylpyrimidine is COc1nc(C)c(Cl)c(OC)n1.
What is the InChIKey of 5-chloro-2,4-dimethoxy-6-methylpyrimidine?
The InChIKey is BVDYUCCIJBGAEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O2/c1-4-5(8)6(11-2)10-7(9-4)12-3/h1-3H3.
What are the key properties of 5-chloro-2,4-dimethoxy-6-methylpyrimidine?
5-chloro-2,4-dimethoxy-6-methylpyrimidine has a molecular weight of 188.61 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,4-dimethoxy-6-methylpyrimidine is sourced from PubChem (CID 45058582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).