C13H16N4O3S3 — CID 45058916
1-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)-3-[(4-methylphenyl)sulfonylamino]urea (PubChem CID 45058916) has the molecular formula C13H16N4O3S3 and a molecular weight of 372.50 g/mol. Its IUPAC name is 1-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)-3-[(4-methylphenyl)sulfonylamino]urea.
| Compound Name | 1-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)-3-[(4-methylphenyl)sulfonylamino]urea |
|---|---|
| PubChem CID | 45058916 |
| Molecular Formula | C13H16N4O3S3 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 1-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)-3-[(4-methylphenyl)sulfonylamino]urea |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)Nc2sc(=S)n(C)c2C)cc1 |
| InChI | InChI=1S/C13H16N4O3S3/c1-8-4-6-10(7-5-8)23(19,20)16-15-12(18)14-11-9(2)17(3)13(21)22-11/h4-7,16H,1-3H3,(H2,14,15,18) |
| InChIKey | GDUUNOVIYRMBTH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|