About 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine
5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine (PubChem CID 45059041) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine |
| PubChem CID | 45059041 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine |
| SMILES | CCc1c(C)nc(NC)nc1OC |
| InChI | InChI=1S/C9H15N3O/c1-5-7-6(2)11-9(10-3)12-8(7)13-4/h5H2,1-4H3,(H,10,11,12) |
| InChIKey | JCSPMARRNGTFMN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine?
The IUPAC name of 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine (CID 45059041) is 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine.
What is the SMILES notation for 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine?
The canonical SMILES for 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine is CCc1c(C)nc(NC)nc1OC.
What is the InChIKey of 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine?
The InChIKey is JCSPMARRNGTFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-5-7-6(2)11-9(10-3)12-8(7)13-4/h5H2,1-4H3,(H,10,11,12).
What are the key properties of 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine?
5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine has a molecular weight of 181.24 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-methoxy-N,6-dimethylpyrimidin-2-amine is sourced from PubChem (CID 45059041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).