C19H22N4O3 — CID 45059559
N-[4-(hydrazinecarbonyl)phenyl]-N'-(4-phenylbutan-2-yl)oxamide (PubChem CID 45059559) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[4-(hydrazinecarbonyl)phenyl]-N'-(4-phenylbutan-2-yl)oxamide.
| Compound Name | N-[4-(hydrazinecarbonyl)phenyl]-N'-(4-phenylbutan-2-yl)oxamide |
|---|---|
| PubChem CID | 45059559 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[4-(hydrazinecarbonyl)phenyl]-N'-(4-phenylbutan-2-yl)oxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)C(=O)Nc1ccc(C(=O)NN)cc1 |
| InChI | InChI=1S/C19H22N4O3/c1-13(7-8-14-5-3-2-4-6-14)21-18(25)19(26)22-16-11-9-15(10-12-16)17(24)23-20/h2-6,9-13H,7-8,20H2,1H3,(H,21,25)(H,22,26)(H,23,24) |
| InChIKey | BBVGRFAMOKPXLG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|