C16H22N2O2 — CID 4506010
N-[(2-ethylcyclopentylidene)amino]-2-(4-methoxyphenyl)acetamide (PubChem CID 4506010) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[(2-ethylcyclopentylidene)amino]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(2-ethylcyclopentylidene)amino]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4506010 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[(2-ethylcyclopentylidene)amino]-2-(4-methoxyphenyl)acetamide |
| SMILES | CCC1CCCC1=NNC(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H22N2O2/c1-3-13-5-4-6-15(13)17-18-16(19)11-12-7-9-14(20-2)10-8-12/h7-10,13H,3-6,11H2,1-2H3,(H,18,19) |
| InChIKey | PWJCKJINAPBRHN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|