C16H18N2O2S2 — CID 4506209
methyl 5-methyl-2-[(4-methylphenyl)methylcarbamothioylamino]thiophene-3-carboxylate (PubChem CID 4506209) has the molecular formula C16H18N2O2S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is methyl 5-methyl-2-[(4-methylphenyl)methylcarbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-2-[(4-methylphenyl)methylcarbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4506209 |
| Molecular Formula | C16H18N2O2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | methyl 5-methyl-2-[(4-methylphenyl)methylcarbamothioylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(C)sc1NC(=S)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C16H18N2O2S2/c1-10-4-6-12(7-5-10)9-17-16(21)18-14-13(15(19)20-3)8-11(2)22-14/h4-8H,9H2,1-3H3,(H2,17,18,21) |
| InChIKey | FYUXVELHMKBCJG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|