C8H13N3O2 — CID 45071934
6-pentyl-2H-1,2,4-triazine-3,5-dione (PubChem CID 45071934) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 6-pentyl-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-pentyl-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 45071934 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 6-pentyl-2H-1,2,4-triazine-3,5-dione |
| SMILES | CCCCCc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O2/c1-2-3-4-5-6-7(12)9-8(13)11-10-6/h2-5H2,1H3,(H2,9,11,12,13) |
| InChIKey | GZPLKGBFEYEFLF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|