About 2-(2,5-dioxoimidazolidin-4-yl)guanidine
2-(2,5-dioxoimidazolidin-4-yl)guanidine (PubChem CID 45071972) has the molecular formula C4H7N5O2
and a molecular weight of 157.13 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-4-yl)guanidine.
Molecular Properties
| Compound Name | 2-(2,5-dioxoimidazolidin-4-yl)guanidine |
| PubChem CID | 45071972 |
| Molecular Formula | C4H7N5O2 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-4-yl)guanidine |
| SMILES | NC(N)=NC1NC(=O)NC1=O |
| InChI | InChI=1S/C4H7N5O2/c5-3(6)7-1-2(10)9-4(11)8-1/h1H,(H4,5,6,7)(H2,8,9,10,11) |
| InChIKey | AVOMHQCKYPXFNU-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxoimidazolidin-4-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxoimidazolidin-4-yl)guanidine?
The IUPAC name of 2-(2,5-dioxoimidazolidin-4-yl)guanidine (CID 45071972) is 2-(2,5-dioxoimidazolidin-4-yl)guanidine.
What is the SMILES notation for 2-(2,5-dioxoimidazolidin-4-yl)guanidine?
The canonical SMILES for 2-(2,5-dioxoimidazolidin-4-yl)guanidine is NC(N)=NC1NC(=O)NC1=O.
What is the InChIKey of 2-(2,5-dioxoimidazolidin-4-yl)guanidine?
The InChIKey is AVOMHQCKYPXFNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5O2/c5-3(6)7-1-2(10)9-4(11)8-1/h1H,(H4,5,6,7)(H2,8,9,10,11).
What are the key properties of 2-(2,5-dioxoimidazolidin-4-yl)guanidine?
2-(2,5-dioxoimidazolidin-4-yl)guanidine has a molecular weight of 157.13 g/mol, XLogP of -2.57, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxoimidazolidin-4-yl)guanidine is sourced from PubChem (CID 45071972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).