About 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride
5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride (PubChem CID 45073427) has the molecular formula C16H16Cl2N2O2
and a molecular weight of 339.22 g/mol. Its IUPAC name is 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride.
Molecular Properties
| Compound Name | 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride |
| PubChem CID | 45073427 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride |
| SMILES | COc1cc(OC)c2cc(-c3ccncc3)cnc2c1.Cl.Cl |
| InChI | InChI=1S/C16H14N2O2.2ClH/c1-19-13-8-15-14(16(9-13)20-2)7-12(10-18-15)11-3-5-17-6-4-11;;/h3-10H,1-2H3;2*1H |
| InChIKey | YBBAOKYVJCNJIV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride?
The IUPAC name of 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride (CID 45073427) is 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride.
What is the SMILES notation for 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride?
The canonical SMILES for 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride is COc1cc(OC)c2cc(-c3ccncc3)cnc2c1.Cl.Cl.
What is the InChIKey of 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride?
The InChIKey is YBBAOKYVJCNJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2.2ClH/c1-19-13-8-15-14(16(9-13)20-2)7-12(10-18-15)11-3-5-17-6-4-11;;/h3-10H,1-2H3;2*1H.
What are the key properties of 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride?
5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride has a molecular weight of 339.22 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethoxy-3-pyridin-4-ylquinoline;dihydrochloride is sourced from PubChem (CID 45073427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).