C11H17N3O8 — CID 45073455
(1R,9S,12S)-3-amino-14-(hydroxymethyl)-8,10-dioxa-2,4-diazatetracyclo[7.3.1.17,11.01,6]tetradec-3-ene-5,9,12,13,14-pentol (PubChem CID 45073455) has the molecular formula C11H17N3O8 and a molecular weight of 319.27 g/mol. Its IUPAC name is (1R,9S,12S)-3-amino-14-(hydroxymethyl)-8,10-dioxa-2,4-diazatetracyclo[7.3.1.17,11.01,6]tetradec-3-ene-5,9,12,13,14-pentol.
| Compound Name | (1R,9S,12S)-3-amino-14-(hydroxymethyl)-8,10-dioxa-2,4-diazatetracyclo[7.3.1.17,11.01,6]tetradec-3-ene-5,9,12,13,14-pentol |
|---|---|
| PubChem CID | 45073455 |
| Molecular Formula | C11H17N3O8 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (1R,9S,12S)-3-amino-14-(hydroxymethyl)-8,10-dioxa-2,4-diazatetracyclo[7.3.1.17,11.01,6]tetradec-3-ene-5,9,12,13,14-pentol |
| SMILES | NC1=NC(O)C2C3O[C@]4(O)OC([C@@H](O)[C@@]2(N1)C4O)C3(O)CO |
| InChI | InChI=1S/C11H17N3O8/c12-8-13-6(17)2-4-9(19,1-15)5-3(16)10(2,14-8)7(18)11(20,21-4)22-5/h2-7,15-20H,1H2,(H3,12,13,14)/t2?,3-,4?,5?,6?,7?,9?,10-,11+/m1/s1 |
| InChIKey | CFMYXEVWODSLAX-JUNILESCSA-N |
| XLogP | -5.52 |
| TPSA | 190.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |