About 4-(furan-3-yl)piperidine
4-(furan-3-yl)piperidine (PubChem CID 45073799) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-(furan-3-yl)piperidine.
Molecular Properties
| Compound Name | 4-(furan-3-yl)piperidine |
| PubChem CID | 45073799 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-(furan-3-yl)piperidine |
| SMILES | c1cc(C2CCNCC2)co1 |
| InChI | InChI=1S/C9H13NO/c1-4-10-5-2-8(1)9-3-6-11-7-9/h3,6-8,10H,1-2,4-5H2 |
| InChIKey | SZWFKWLVQFPBGD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(furan-3-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-3-yl)piperidine?
The IUPAC name of 4-(furan-3-yl)piperidine (CID 45073799) is 4-(furan-3-yl)piperidine.
What is the SMILES notation for 4-(furan-3-yl)piperidine?
The canonical SMILES for 4-(furan-3-yl)piperidine is c1cc(C2CCNCC2)co1.
What is the InChIKey of 4-(furan-3-yl)piperidine?
The InChIKey is SZWFKWLVQFPBGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-4-10-5-2-8(1)9-3-6-11-7-9/h3,6-8,10H,1-2,4-5H2.
What are the key properties of 4-(furan-3-yl)piperidine?
4-(furan-3-yl)piperidine has a molecular weight of 151.21 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-3-yl)piperidine is sourced from PubChem (CID 45073799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).