About spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine]
spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine] (PubChem CID 45073937) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine].
Molecular Properties
| Compound Name | spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine] |
| PubChem CID | 45073937 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine] |
| SMILES | c1ccc2c(c1)CC21CCNC1 |
| InChI | InChI=1S/C11H13N/c1-2-4-10-9(3-1)7-11(10)5-6-12-8-11/h1-4,12H,5-8H2 |
| InChIKey | OHLUCRDUTNQEFD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine]?
The IUPAC name of spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine] (CID 45073937) is spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine].
What is the SMILES notation for spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine]?
The canonical SMILES for spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine] is c1ccc2c(c1)CC21CCNC1.
What is the InChIKey of spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine]?
The InChIKey is OHLUCRDUTNQEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-2-4-10-9(3-1)7-11(10)5-6-12-8-11/h1-4,12H,5-8H2.
What are the key properties of spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine]?
spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine] has a molecular weight of 159.23 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-pyrrolidine] is sourced from PubChem (CID 45073937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).