C9H11BrClN — CID 45073969
7-bromo-1,2,3,4-tetrahydroisoquinoline;hydrochloride (PubChem CID 45073969) has the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. Its IUPAC name is 7-bromo-1,2,3,4-tetrahydroisoquinoline;hydrochloride.
| Compound Name | 7-bromo-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 45073969 |
| Molecular Formula | C9H11BrClN |
| Molecular Weight | 248.55 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 7-bromo-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| SMILES | Brc1ccc2c(c1)CNCC2.Cl |
| InChI | InChI=1S/C9H10BrN.ClH/c10-9-2-1-7-3-4-11-6-8(7)5-9;/h1-2,5,11H,3-4,6H2;1H |
| InChIKey | GAQFCKRSCLDDJH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |