About 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one
2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 45074064) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one |
| PubChem CID | 45074064 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | CC(C)N1CCC2(CCNCC2)C1=O |
| InChI | InChI=1S/C11H20N2O/c1-9(2)13-8-5-11(10(13)14)3-6-12-7-4-11/h9,12H,3-8H2,1-2H3 |
| InChIKey | CIQSILGSVXSCIF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one?
The IUPAC name of 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one (CID 45074064) is 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one.
What is the SMILES notation for 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one?
The canonical SMILES for 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one is CC(C)N1CCC2(CCNCC2)C1=O.
What is the InChIKey of 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one?
The InChIKey is CIQSILGSVXSCIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-9(2)13-8-5-11(10(13)14)3-6-12-7-4-11/h9,12H,3-8H2,1-2H3.
What are the key properties of 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one?
2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one has a molecular weight of 196.29 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-2,8-diazaspiro[4.5]decan-1-one is sourced from PubChem (CID 45074064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).