C9H13ClN2O6 — CID 45074628
5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione (PubChem CID 45074628) has the molecular formula C9H13ClN2O6 and a molecular weight of 280.66 g/mol. Its IUPAC name is 5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 45074628 |
| Molecular Formula | C9H13ClN2O6 |
| Molecular Weight | 280.66 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 5-chloro-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC(=O)N([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)CC1Cl |
| InChI | InChI=1S/C9H13ClN2O6/c10-3-1-12(9(17)11-7(3)16)8-6(15)5(14)4(2-13)18-8/h3-6,8,13-15H,1-2H2,(H,11,16,17)/t3?,4-,5-,6-,8-/m1/s1 |
| InChIKey | CQIUQMUMSMAQKW-NLQUXFCRSA-N |
| XLogP | -2.42 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.66 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|