C9H10F7I — CID 45074728
trans-(1S,2R)-1-(1,1,2,2,3,3,3-heptafluoropropyl)-2-iodocyclohexane (PubChem CID 45074728) has the molecular formula C9H10F7I and a molecular weight of 378.07 g/mol. Its IUPAC name is trans-(1S,2R)-1-(1,1,2,2,3,3,3-heptafluoropropyl)-2-iodocyclohexane.
| Compound Name | trans-(1S,2R)-1-(1,1,2,2,3,3,3-heptafluoropropyl)-2-iodocyclohexane |
|---|---|
| PubChem CID | 45074728 |
| Molecular Formula | C9H10F7I |
| Molecular Weight | 378.07 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | trans-(1S,2R)-1-(1,1,2,2,3,3,3-heptafluoropropyl)-2-iodocyclohexane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)[C@@H]1CCCC[C@H]1I |
| InChI | InChI=1S/C9H10F7I/c10-7(11,8(12,13)9(14,15)16)5-3-1-2-4-6(5)17/h5-6H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | OPDPCHBOZHWKOZ-PHDIDXHHSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.07 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|