C20H21F3N2O3 — CID 45074775
2,2-diphenyl-1-piperazin-1-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 45074775) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is 2,2-diphenyl-1-piperazin-1-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2,2-diphenyl-1-piperazin-1-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 45074775 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2,2-diphenyl-1-piperazin-1-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H20N2O.C2HF3O2/c21-18(20-13-11-19-12-14-20)17(15-7-3-1-4-8-15)16-9-5-2-6-10-16;3-2(4,5)1(6)7/h1-10,17,19H,11-14H2;(H,6,7) |
| InChIKey | XTLPASSNHDZTMV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |