About 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride
3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride (PubChem CID 45074813) has the molecular formula C8H10ClNO2
and a molecular weight of 187.63 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride |
| PubChem CID | 45074813 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride |
| SMILES | Cl.Oc1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C8H9NO2.ClH/c10-6-1-2-8-7(5-6)9-3-4-11-8;/h1-2,5,9-10H,3-4H2;1H |
| InChIKey | GQUONSJRMSKBGP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride?
The IUPAC name of 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride (CID 45074813) is 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride.
What is the SMILES notation for 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride?
The canonical SMILES for 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride is Cl.Oc1ccc2c(c1)NCCO2.
What is the InChIKey of 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride?
The InChIKey is GQUONSJRMSKBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.ClH/c10-6-1-2-8-7(5-6)9-3-4-11-8;/h1-2,5,9-10H,3-4H2;1H.
What are the key properties of 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride?
3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride has a molecular weight of 187.63 g/mol, XLogP of 1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-1,4-benzoxazin-6-ol;hydrochloride is sourced from PubChem (CID 45074813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).