About 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride
5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride (PubChem CID 45074817) has the molecular formula C7H6Cl2N2O2S2
and a molecular weight of 285.18 g/mol. Its IUPAC name is 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride |
| PubChem CID | 45074817 |
| Molecular Formula | C7H6Cl2N2O2S2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 283.92 |
| IUPAC Name | 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride |
| SMILES | Cc1ccc2nsnc2c1S(=O)(=O)Cl.Cl |
| InChI | InChI=1S/C7H5ClN2O2S2.ClH/c1-4-2-3-5-6(10-13-9-5)7(4)14(8,11)12;/h2-3H,1H3;1H |
| InChIKey | MPTNWEHZPWASLC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride?
The IUPAC name of 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride (CID 45074817) is 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride.
What is the SMILES notation for 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride?
The canonical SMILES for 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride is Cc1ccc2nsnc2c1S(=O)(=O)Cl.Cl.
What is the InChIKey of 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride?
The InChIKey is MPTNWEHZPWASLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O2S2.ClH/c1-4-2-3-5-6(10-13-9-5)7(4)14(8,11)12;/h2-3H,1H3;1H.
What are the key properties of 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride?
5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride has a molecular weight of 285.18 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,1,3-benzothiadiazole-4-sulfonyl chloride;hydrochloride is sourced from PubChem (CID 45074817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).