C5BrF11O — CID 45075722
2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-1,1,1,2,3,3,3-heptafluoropropane (PubChem CID 45075722) has the molecular formula C5BrF11O and a molecular weight of 364.94 g/mol. Its IUPAC name is 2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-1,1,1,2,3,3,3-heptafluoropropane.
| Compound Name | 2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-1,1,1,2,3,3,3-heptafluoropropane |
|---|---|
| PubChem CID | 45075722 |
| Molecular Formula | C5BrF11O |
| Molecular Weight | 364.94 g/mol |
| Exact Mass | 363.90 |
| IUPAC Name | 2-(2-bromo-1,1,2,2-tetrafluoroethoxy)-1,1,1,2,3,3,3-heptafluoropropane |
| SMILES | FC(F)(F)C(F)(OC(F)(F)C(F)(F)Br)C(F)(F)F |
| InChI | InChI=1S/C5BrF11O/c6-2(8,9)5(16,17)18-1(7,3(10,11)12)4(13,14)15 |
| InChIKey | NNJIYASXBPPIGU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.94 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|