About 7-methylthieno[3,4-c]pyridine-1,3-diamine
7-methylthieno[3,4-c]pyridine-1,3-diamine (PubChem CID 45077087) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is 7-methylthieno[3,4-c]pyridine-1,3-diamine.
Molecular Properties
| Compound Name | 7-methylthieno[3,4-c]pyridine-1,3-diamine |
| PubChem CID | 45077087 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 7-methylthieno[3,4-c]pyridine-1,3-diamine |
| SMILES | Cc1cncc2c(N)sc(N)c12 |
| InChI | InChI=1S/C8H9N3S/c1-4-2-11-3-5-6(4)8(10)12-7(5)9/h2-3H,9-10H2,1H3 |
| InChIKey | WKOLEKBUXHRZEG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methylthieno[3,4-c]pyridine-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylthieno[3,4-c]pyridine-1,3-diamine?
The IUPAC name of 7-methylthieno[3,4-c]pyridine-1,3-diamine (CID 45077087) is 7-methylthieno[3,4-c]pyridine-1,3-diamine.
What is the SMILES notation for 7-methylthieno[3,4-c]pyridine-1,3-diamine?
The canonical SMILES for 7-methylthieno[3,4-c]pyridine-1,3-diamine is Cc1cncc2c(N)sc(N)c12.
What is the InChIKey of 7-methylthieno[3,4-c]pyridine-1,3-diamine?
The InChIKey is WKOLEKBUXHRZEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c1-4-2-11-3-5-6(4)8(10)12-7(5)9/h2-3H,9-10H2,1H3.
What are the key properties of 7-methylthieno[3,4-c]pyridine-1,3-diamine?
7-methylthieno[3,4-c]pyridine-1,3-diamine has a molecular weight of 179.25 g/mol, XLogP of 1.77, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylthieno[3,4-c]pyridine-1,3-diamine is sourced from PubChem (CID 45077087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).