About 4-ethyl-5-isothiocyanato-1,3-benzothiazole
4-ethyl-5-isothiocyanato-1,3-benzothiazole (PubChem CID 45077152) has the molecular formula C10H8N2S2
and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-ethyl-5-isothiocyanato-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-ethyl-5-isothiocyanato-1,3-benzothiazole |
| PubChem CID | 45077152 |
| Molecular Formula | C10H8N2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 4-ethyl-5-isothiocyanato-1,3-benzothiazole |
| SMILES | CCc1c(N=C=S)ccc2scnc12 |
| InChI | InChI=1S/C10H8N2S2/c1-2-7-8(11-5-13)3-4-9-10(7)12-6-14-9/h3-4,6H,2H2,1H3 |
| InChIKey | NSLZLJPOUSOIFT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-5-isothiocyanato-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-isothiocyanato-1,3-benzothiazole?
The IUPAC name of 4-ethyl-5-isothiocyanato-1,3-benzothiazole (CID 45077152) is 4-ethyl-5-isothiocyanato-1,3-benzothiazole.
What is the SMILES notation for 4-ethyl-5-isothiocyanato-1,3-benzothiazole?
The canonical SMILES for 4-ethyl-5-isothiocyanato-1,3-benzothiazole is CCc1c(N=C=S)ccc2scnc12.
What is the InChIKey of 4-ethyl-5-isothiocyanato-1,3-benzothiazole?
The InChIKey is NSLZLJPOUSOIFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S2/c1-2-7-8(11-5-13)3-4-9-10(7)12-6-14-9/h3-4,6H,2H2,1H3.
What are the key properties of 4-ethyl-5-isothiocyanato-1,3-benzothiazole?
4-ethyl-5-isothiocyanato-1,3-benzothiazole has a molecular weight of 220.32 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-isothiocyanato-1,3-benzothiazole is sourced from PubChem (CID 45077152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).