About thieno[3,2-g][1,3]benzothiazole
thieno[3,2-g][1,3]benzothiazole (PubChem CID 45077418) has the molecular formula C9H5NS2
and a molecular weight of 191.28 g/mol. Its IUPAC name is thieno[3,2-g][1,3]benzothiazole.
Molecular Properties
| Compound Name | thieno[3,2-g][1,3]benzothiazole |
| PubChem CID | 45077418 |
| Molecular Formula | C9H5NS2 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | thieno[3,2-g][1,3]benzothiazole |
| SMILES | c1cc2ccc3ncsc3c2s1 |
| InChI | InChI=1S/C9H5NS2/c1-2-7-9(12-5-10-7)8-6(1)3-4-11-8/h1-5H |
| InChIKey | OMLSVERONWZGEC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[3,2-g][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-g][1,3]benzothiazole?
The IUPAC name of thieno[3,2-g][1,3]benzothiazole (CID 45077418) is thieno[3,2-g][1,3]benzothiazole.
What is the SMILES notation for thieno[3,2-g][1,3]benzothiazole?
The canonical SMILES for thieno[3,2-g][1,3]benzothiazole is c1cc2ccc3ncsc3c2s1.
What is the InChIKey of thieno[3,2-g][1,3]benzothiazole?
The InChIKey is OMLSVERONWZGEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NS2/c1-2-7-9(12-5-10-7)8-6(1)3-4-11-8/h1-5H.
What are the key properties of thieno[3,2-g][1,3]benzothiazole?
thieno[3,2-g][1,3]benzothiazole has a molecular weight of 191.28 g/mol, XLogP of 3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-g][1,3]benzothiazole is sourced from PubChem (CID 45077418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).