About 2H-pyrrolo[3,2-f][1,3]benzothiazole
2H-pyrrolo[3,2-f][1,3]benzothiazole (PubChem CID 45077423) has the molecular formula C9H6N2S
and a molecular weight of 174.23 g/mol. Its IUPAC name is 2H-pyrrolo[3,2-f][1,3]benzothiazole.
Molecular Properties
| Compound Name | 2H-pyrrolo[3,2-f][1,3]benzothiazole |
| PubChem CID | 45077423 |
| Molecular Formula | C9H6N2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 2H-pyrrolo[3,2-f][1,3]benzothiazole |
| SMILES | C1=Cc2cc3c(cc2=N1)SCN=3 |
| InChI | InChI=1S/C9H6N2S/c1-2-10-7-4-9-8(3-6(1)7)11-5-12-9/h1-4H,5H2 |
| InChIKey | CMESBQADLBHGPY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2H-pyrrolo[3,2-f][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrrolo[3,2-f][1,3]benzothiazole?
The IUPAC name of 2H-pyrrolo[3,2-f][1,3]benzothiazole (CID 45077423) is 2H-pyrrolo[3,2-f][1,3]benzothiazole.
What is the SMILES notation for 2H-pyrrolo[3,2-f][1,3]benzothiazole?
The canonical SMILES for 2H-pyrrolo[3,2-f][1,3]benzothiazole is C1=Cc2cc3c(cc2=N1)SCN=3.
What is the InChIKey of 2H-pyrrolo[3,2-f][1,3]benzothiazole?
The InChIKey is CMESBQADLBHGPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2S/c1-2-10-7-4-9-8(3-6(1)7)11-5-12-9/h1-4H,5H2.
What are the key properties of 2H-pyrrolo[3,2-f][1,3]benzothiazole?
2H-pyrrolo[3,2-f][1,3]benzothiazole has a molecular weight of 174.23 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrrolo[3,2-f][1,3]benzothiazole is sourced from PubChem (CID 45077423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).