About N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide
N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide (PubChem CID 45077712) has the molecular formula C10H11N3OS
and a molecular weight of 221.28 g/mol. Its IUPAC name is N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide |
| PubChem CID | 45077712 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide |
| SMILES | CNc1nc2ccc(NC(C)=O)cc2s1 |
| InChI | InChI=1S/C10H11N3OS/c1-6(14)12-7-3-4-8-9(5-7)15-10(11-2)13-8/h3-5H,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | YPYAGNMJHWIZMQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide?
The IUPAC name of N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide (CID 45077712) is N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide.
What is the SMILES notation for N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide?
The canonical SMILES for N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide is CNc1nc2ccc(NC(C)=O)cc2s1.
What is the InChIKey of N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide?
The InChIKey is YPYAGNMJHWIZMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS/c1-6(14)12-7-3-4-8-9(5-7)15-10(11-2)13-8/h3-5H,1-2H3,(H,11,13)(H,12,14).
What are the key properties of N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide?
N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide has a molecular weight of 221.28 g/mol, XLogP of 2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(methylamino)-1,3-benzothiazol-6-yl]acetamide is sourced from PubChem (CID 45077712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).