About 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole
8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole (PubChem CID 45077984) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole |
| PubChem CID | 45077984 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole |
| SMILES | Cc1cccc2nc3n(c12)CCC3 |
| InChI | InChI=1S/C11H12N2/c1-8-4-2-5-9-11(8)13-7-3-6-10(13)12-9/h2,4-5H,3,6-7H2,1H3 |
| InChIKey | COSXRBNJOSAACZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
The IUPAC name of 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole (CID 45077984) is 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole.
What is the SMILES notation for 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
The canonical SMILES for 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole is Cc1cccc2nc3n(c12)CCC3.
What is the InChIKey of 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
The InChIKey is COSXRBNJOSAACZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-8-4-2-5-9-11(8)13-7-3-6-10(13)12-9/h2,4-5H,3,6-7H2,1H3.
What are the key properties of 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole?
8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole has a molecular weight of 172.23 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole is sourced from PubChem (CID 45077984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).