About 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one
6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one (PubChem CID 45078064) has the molecular formula C11H9N3O
and a molecular weight of 199.21 g/mol. Its IUPAC name is 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one.
Molecular Properties
| Compound Name | 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one |
| PubChem CID | 45078064 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one |
| SMILES | Nc1cccc2c1ccc1[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C11H9N3O/c12-8-3-1-2-7-6(8)4-5-9-10(7)14-11(15)13-9/h1-5H,12H2,(H2,13,14,15) |
| InChIKey | SSPYYOFYWBCORO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one?
The IUPAC name of 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one (CID 45078064) is 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one.
What is the SMILES notation for 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one?
The canonical SMILES for 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one is Nc1cccc2c1ccc1[nH]c(=O)[nH]c12.
What is the InChIKey of 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one?
The InChIKey is SSPYYOFYWBCORO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O/c12-8-3-1-2-7-6(8)4-5-9-10(7)14-11(15)13-9/h1-5H,12H2,(H2,13,14,15).
What are the key properties of 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one?
6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one has a molecular weight of 199.21 g/mol, XLogP of 1.59, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,3-dihydrobenzo[e]benzimidazol-2-one is sourced from PubChem (CID 45078064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).