About 3-methylimidazo[4,5-f]quinoxaline
3-methylimidazo[4,5-f]quinoxaline (PubChem CID 45078085) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-methylimidazo[4,5-f]quinoxaline.
Molecular Properties
| Compound Name | 3-methylimidazo[4,5-f]quinoxaline |
| PubChem CID | 45078085 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-methylimidazo[4,5-f]quinoxaline |
| SMILES | Cn1cnc2c3nccnc3ccc21 |
| InChI | InChI=1S/C10H8N4/c1-14-6-13-10-8(14)3-2-7-9(10)12-5-4-11-7/h2-6H,1H3 |
| InChIKey | LUMSACMEZQCYBR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylimidazo[4,5-f]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylimidazo[4,5-f]quinoxaline?
The IUPAC name of 3-methylimidazo[4,5-f]quinoxaline (CID 45078085) is 3-methylimidazo[4,5-f]quinoxaline.
What is the SMILES notation for 3-methylimidazo[4,5-f]quinoxaline?
The canonical SMILES for 3-methylimidazo[4,5-f]quinoxaline is Cn1cnc2c3nccnc3ccc21.
What is the InChIKey of 3-methylimidazo[4,5-f]quinoxaline?
The InChIKey is LUMSACMEZQCYBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4/c1-14-6-13-10-8(14)3-2-7-9(10)12-5-4-11-7/h2-6H,1H3.
What are the key properties of 3-methylimidazo[4,5-f]quinoxaline?
3-methylimidazo[4,5-f]quinoxaline has a molecular weight of 184.20 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylimidazo[4,5-f]quinoxaline is sourced from PubChem (CID 45078085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).