C8H5N3 — CID 45078299
2,4,5-triazatricyclo[5.3.1.04,11]undeca-1(10),2,5,7(11),8-pentaene (PubChem CID 45078299) has the molecular formula C8H5N3 and a molecular weight of 143.15 g/mol. Its IUPAC name is 2,4,5-triazatricyclo[5.3.1.04,11]undeca-1(10),2,5,7(11),8-pentaene.
| Compound Name | 2,4,5-triazatricyclo[5.3.1.04,11]undeca-1(10),2,5,7(11),8-pentaene |
|---|---|
| PubChem CID | 45078299 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 2,4,5-triazatricyclo[5.3.1.04,11]undeca-1(10),2,5,7(11),8-pentaene |
| SMILES | c1cc2cnn3cnc(c1)c23 |
| InChI | InChI=1S/C8H5N3/c1-2-6-4-10-11-5-9-7(3-1)8(6)11/h1-5H |
| InChIKey | QPHDDQPXIJZGOK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |