About 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde
4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde (PubChem CID 45078304) has the molecular formula C10H7N3O
and a molecular weight of 185.19 g/mol. Its IUPAC name is 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde.
Molecular Properties
| Compound Name | 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde |
| PubChem CID | 45078304 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde |
| SMILES | O=Cc1cnc2[nH]c3ccccc3n12 |
| InChI | InChI=1S/C10H7N3O/c14-6-7-5-11-10-12-8-3-1-2-4-9(8)13(7)10/h1-6H,(H,11,12) |
| InChIKey | SSKOJFDTFDUPFH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde?
The IUPAC name of 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde (CID 45078304) is 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde.
What is the SMILES notation for 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde?
The canonical SMILES for 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde is O=Cc1cnc2[nH]c3ccccc3n12.
What is the InChIKey of 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde?
The InChIKey is SSKOJFDTFDUPFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O/c14-6-7-5-11-10-12-8-3-1-2-4-9(8)13(7)10/h1-6H,(H,11,12).
What are the key properties of 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde?
4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde has a molecular weight of 185.19 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-imidazo[1,2-a]benzimidazole-1-carbaldehyde is sourced from PubChem (CID 45078304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).