About 2H-imidazo[4,5-g]quinoline
2H-imidazo[4,5-g]quinoline (PubChem CID 45078387) has the molecular formula C10H7N3
and a molecular weight of 169.19 g/mol. Its IUPAC name is 2H-imidazo[4,5-g]quinoline.
Molecular Properties
| Compound Name | 2H-imidazo[4,5-g]quinoline |
| PubChem CID | 45078387 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 2H-imidazo[4,5-g]quinoline |
| SMILES | c1cnc2cc3c(cc2c1)=NCN=3 |
| InChI | InChI=1S/C10H7N3/c1-2-7-4-9-10(13-6-12-9)5-8(7)11-3-1/h1-5H,6H2 |
| InChIKey | KLIKLSQJEIMBRW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-imidazo[4,5-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-imidazo[4,5-g]quinoline?
The IUPAC name of 2H-imidazo[4,5-g]quinoline (CID 45078387) is 2H-imidazo[4,5-g]quinoline.
What is the SMILES notation for 2H-imidazo[4,5-g]quinoline?
The canonical SMILES for 2H-imidazo[4,5-g]quinoline is c1cnc2cc3c(cc2c1)=NCN=3.
What is the InChIKey of 2H-imidazo[4,5-g]quinoline?
The InChIKey is KLIKLSQJEIMBRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3/c1-2-7-4-9-10(13-6-12-9)5-8(7)11-3-1/h1-5H,6H2.
What are the key properties of 2H-imidazo[4,5-g]quinoline?
2H-imidazo[4,5-g]quinoline has a molecular weight of 169.19 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-imidazo[4,5-g]quinoline is sourced from PubChem (CID 45078387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).