About 6-amino-3,4-dihydro-1H-pyrimidine-2-thione
6-amino-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 45078846) has the molecular formula C4H7N3S
and a molecular weight of 129.19 g/mol. Its IUPAC name is 6-amino-3,4-dihydro-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 6-amino-3,4-dihydro-1H-pyrimidine-2-thione |
| PubChem CID | 45078846 |
| Molecular Formula | C4H7N3S |
| Molecular Weight | 129.19 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 6-amino-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | NC1=CCNC(=S)N1 |
| InChI | InChI=1S/C4H7N3S/c5-3-1-2-6-4(8)7-3/h1H,2,5H2,(H2,6,7,8) |
| InChIKey | RNVGSNLARHVBHJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3,4-dihydro-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,4-dihydro-1H-pyrimidine-2-thione?
The IUPAC name of 6-amino-3,4-dihydro-1H-pyrimidine-2-thione (CID 45078846) is 6-amino-3,4-dihydro-1H-pyrimidine-2-thione.
What is the SMILES notation for 6-amino-3,4-dihydro-1H-pyrimidine-2-thione?
The canonical SMILES for 6-amino-3,4-dihydro-1H-pyrimidine-2-thione is NC1=CCNC(=S)N1.
What is the InChIKey of 6-amino-3,4-dihydro-1H-pyrimidine-2-thione?
The InChIKey is RNVGSNLARHVBHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3S/c5-3-1-2-6-4(8)7-3/h1H,2,5H2,(H2,6,7,8).
What are the key properties of 6-amino-3,4-dihydro-1H-pyrimidine-2-thione?
6-amino-3,4-dihydro-1H-pyrimidine-2-thione has a molecular weight of 129.19 g/mol, XLogP of -0.74, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,4-dihydro-1H-pyrimidine-2-thione is sourced from PubChem (CID 45078846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).