C6H11NO3 — CID 45078911
(1R,2S,3R,6S)-6-aminocyclohex-4-ene-1,2,3-triol (PubChem CID 45078911) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is (1R,2S,3R,6S)-6-aminocyclohex-4-ene-1,2,3-triol.
| Compound Name | (1R,2S,3R,6S)-6-aminocyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 45078911 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (1R,2S,3R,6S)-6-aminocyclohex-4-ene-1,2,3-triol |
| SMILES | N[C@H]1C=C[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11NO3/c7-3-1-2-4(8)6(10)5(3)9/h1-6,8-10H,7H2/t3-,4+,5+,6-/m0/s1 |
| InChIKey | RAJLHDDMNNFKNT-KCDKBNATSA-N |
| XLogP | -2.03 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|