About 1,4-diethynylcyclohexa-1,4-diene
1,4-diethynylcyclohexa-1,4-diene (PubChem CID 45079123) has the molecular formula C10H8
and a molecular weight of 128.17 g/mol. Its IUPAC name is 1,4-diethynylcyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 1,4-diethynylcyclohexa-1,4-diene |
| PubChem CID | 45079123 |
| Molecular Formula | C10H8 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 1,4-diethynylcyclohexa-1,4-diene |
| SMILES | C#CC1=CCC(C#C)=CC1 |
| InChI | InChI=1S/C10H8/c1-3-9-5-7-10(4-2)8-6-9/h1-2,5,8H,6-7H2 |
| InChIKey | XYXHYEFIMIFXEQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diethynylcyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethynylcyclohexa-1,4-diene?
The IUPAC name of 1,4-diethynylcyclohexa-1,4-diene (CID 45079123) is 1,4-diethynylcyclohexa-1,4-diene.
What is the SMILES notation for 1,4-diethynylcyclohexa-1,4-diene?
The canonical SMILES for 1,4-diethynylcyclohexa-1,4-diene is C#CC1=CCC(C#C)=CC1.
What is the InChIKey of 1,4-diethynylcyclohexa-1,4-diene?
The InChIKey is XYXHYEFIMIFXEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8/c1-3-9-5-7-10(4-2)8-6-9/h1-2,5,8H,6-7H2.
What are the key properties of 1,4-diethynylcyclohexa-1,4-diene?
1,4-diethynylcyclohexa-1,4-diene has a molecular weight of 128.17 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethynylcyclohexa-1,4-diene is sourced from PubChem (CID 45079123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).