About 2,3-diethynylpyrazine
2,3-diethynylpyrazine (PubChem CID 45079129) has the molecular formula C8H4N2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2,3-diethynylpyrazine.
Molecular Properties
| Compound Name | 2,3-diethynylpyrazine |
| PubChem CID | 45079129 |
| Molecular Formula | C8H4N2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 2,3-diethynylpyrazine |
| SMILES | C#Cc1nccnc1C#C |
| InChI | InChI=1S/C8H4N2/c1-3-7-8(4-2)10-6-5-9-7/h1-2,5-6H |
| InChIKey | ICMCNPRRWIIQAY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diethynylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethynylpyrazine?
The IUPAC name of 2,3-diethynylpyrazine (CID 45079129) is 2,3-diethynylpyrazine.
What is the SMILES notation for 2,3-diethynylpyrazine?
The canonical SMILES for 2,3-diethynylpyrazine is C#Cc1nccnc1C#C.
What is the InChIKey of 2,3-diethynylpyrazine?
The InChIKey is ICMCNPRRWIIQAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2/c1-3-7-8(4-2)10-6-5-9-7/h1-2,5-6H.
What are the key properties of 2,3-diethynylpyrazine?
2,3-diethynylpyrazine has a molecular weight of 128.13 g/mol, XLogP of 0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethynylpyrazine is sourced from PubChem (CID 45079129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).